C25H29N3O2 — CID 9245423
N-(2,3-dimethylphenyl)-2-[4-[(2-hydroxynaphthalen-1-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 9245423) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(2-hydroxynaphthalen-1-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(2-hydroxynaphthalen-1-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9245423 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(2-hydroxynaphthalen-1-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(Cc3c(O)ccc4ccccc34)CC2)c1C |
| InChI | InChI=1S/C25H29N3O2/c1-18-6-5-9-23(19(18)2)26-25(30)17-28-14-12-27(13-15-28)16-22-21-8-4-3-7-20(21)10-11-24(22)29/h3-11,29H,12-17H2,1-2H3,(H,26,30) |
| InChIKey | WNKDRPWOIMBAGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|