C14H11N3O4S — CID 924587
N-(4,5-dihydro-1,3-thiazol-2-yl)-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 924587) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 924587 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC1=NCCS1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H11N3O4S/c18-13(16-14-15-7-8-22-14)12-6-5-11(21-12)9-3-1-2-4-10(9)17(19)20/h1-6H,7-8H2,(H,15,16,18) |
| InChIKey | PMAYANJXIMEVQA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|