C10H8Cl2N2OS — CID 924592
3,4-dichloro-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 924592) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is 3,4-dichloro-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 924592 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 3,4-dichloro-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-7-2-1-6(5-8(7)12)9(15)14-10-13-3-4-16-10/h1-2,5H,3-4H2,(H,13,14,15) |
| InChIKey | YSYQCVXDJUMRGQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |