C15H11BrN4OS — CID 9245960
(E)-N-[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 9245960) has the molecular formula C15H11BrN4OS and a molecular weight of 375.25 g/mol. Its IUPAC name is (E)-N-[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 9245960 |
| Molecular Formula | C15H11BrN4OS |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | (E)-N-[5-(2-bromophenyl)-1H-1,2,4-triazol-3-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1n[nH]c(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C15H11BrN4OS/c16-12-6-2-1-5-11(12)14-18-15(20-19-14)17-13(21)8-7-10-4-3-9-22-10/h1-9H,(H2,17,18,19,20,21)/b8-7+ |
| InChIKey | PRLLNSYPFKZJTB-BQYQJAHWSA-N |
| XLogP | 3.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|