C19H18N2O4S2 — CID 9246541
(2R)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-2-phenoxypropanamide (PubChem CID 9246541) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (2R)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-2-phenoxypropanamide.
| Compound Name | (2R)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 9246541 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (2R)-N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]-2-phenoxypropanamide |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)Nc1nc(-c2ccc(S(C)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-13(25-15-6-4-3-5-7-15)18(22)21-19-20-17(12-26-19)14-8-10-16(11-9-14)27(2,23)24/h3-13H,1-2H3,(H,20,21,22)/t13-/m1/s1 |
| InChIKey | TUQGCHZIHFBPCA-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |