About (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one
(3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one (PubChem CID 9247342) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one.
Molecular Properties
| Compound Name | (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one |
| PubChem CID | 9247342 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one |
| SMILES | C[C@H]1C[C@@H]1c1ccc(/C=C2\C(=O)N(C)c3ccccc32)o1 |
| InChI | InChI=1S/C18H17NO2/c1-11-9-14(11)17-8-7-12(21-17)10-15-13-5-3-4-6-16(13)19(2)18(15)20/h3-8,10-11,14H,9H2,1-2H3/b15-10-/t11-,14-/m0/s1 |
| InChIKey | XJDCYFLOWXEWPK-BNBULKTBSA-N |
| XLogP | 3.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one?
The IUPAC name of (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one (CID 9247342) is (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one.
What is the SMILES notation for (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one?
The canonical SMILES for (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one is C[C@H]1C[C@@H]1c1ccc(/C=C2\C(=O)N(C)c3ccccc32)o1.
What is the InChIKey of (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one?
The InChIKey is XJDCYFLOWXEWPK-BNBULKTBSA-N. The full InChI is InChI=1S/C18H17NO2/c1-11-9-14(11)17-8-7-12(21-17)10-15-13-5-3-4-6-16(13)19(2)18(15)20/h3-8,10-11,14H,9H2,1-2H3/b15-10-/t11-,14-/m0/s1.
What are the key properties of (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one?
(3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one has a molecular weight of 279.34 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-methyl-3-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]indol-2-one is sourced from PubChem (CID 9247342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).