C16H15ClN2O3S — CID 9247719
(5Z)-5-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one (PubChem CID 9247719) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is (5Z)-5-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 9247719 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (5Z)-5-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCCC2)S/C1=C\c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H15ClN2O3S/c17-11-6-10(7-12-14(11)22-9-21-12)8-13-15(20)18-16(23-13)19-4-2-1-3-5-19/h6-8H,1-5,9H2/b13-8- |
| InChIKey | CMJJCZSBPBHDAW-JYRVWZFOSA-N |
| XLogP | 3.52 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|