C20H20N2O2S — CID 9247751
(5Z)-3-(3,5-dimethylphenyl)-5-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 9247751) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (5Z)-3-(3,5-dimethylphenyl)-5-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(3,5-dimethylphenyl)-5-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 9247751 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (5Z)-3-(3,5-dimethylphenyl)-5-[[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cc(C)cc(N2C(=O)/C(=C/c3ccc([C@H]4C[C@@H]4C)o3)NC2=S)c1 |
| InChI | InChI=1S/C20H20N2O2S/c1-11-6-12(2)8-14(7-11)22-19(23)17(21-20(22)25)10-15-4-5-18(24-15)16-9-13(16)3/h4-8,10,13,16H,9H2,1-3H3,(H,21,25)/b17-10-/t13-,16-/m0/s1 |
| InChIKey | XWBHZMVWEYSZEL-IURKLMGRSA-N |
| XLogP | 4.28 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|