C21H28N3O+ — CID 9248828
[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]-[(1R)-1-phenylethyl]azanium (PubChem CID 9248828) has the molecular formula C21H28N3O+ and a molecular weight of 338.48 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9248828 |
| Molecular Formula | C21H28N3O+ |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](C)c1ccccc1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N3O/c1-17(19-9-5-3-6-10-19)22-18(2)21(25)24-15-13-23(14-16-24)20-11-7-4-8-12-20/h3-12,17-18,22H,13-16H2,1-2H3/p+1/t17-,18-/m1/s1 |
| InChIKey | DMGNLSVNACWEQL-QZTJIDSGSA-O |
| XLogP | 2.05 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |