C27H24N4O3 — CID 92501188
N-[3-[(S)-(2-methoxyanilino)-pyridin-2-ylmethyl]-2-methyl-1H-indol-5-yl]furan-2-carboxamide (PubChem CID 92501188) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[3-[(S)-(2-methoxyanilino)-pyridin-2-ylmethyl]-2-methyl-1H-indol-5-yl]furan-2-carboxamide.
| Compound Name | N-[3-[(S)-(2-methoxyanilino)-pyridin-2-ylmethyl]-2-methyl-1H-indol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 92501188 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[3-[(S)-(2-methoxyanilino)-pyridin-2-ylmethyl]-2-methyl-1H-indol-5-yl]furan-2-carboxamide |
| SMILES | COc1ccccc1N[C@H](c1ccccn1)c1c(C)[nH]c2ccc(NC(=O)c3ccco3)cc12 |
| InChI | InChI=1S/C27H24N4O3/c1-17-25(19-16-18(12-13-20(19)29-17)30-27(32)24-11-7-15-34-24)26(22-9-5-6-14-28-22)31-21-8-3-4-10-23(21)33-2/h3-16,26,29,31H,1-2H3,(H,30,32)/t26-/m1/s1 |
| InChIKey | VKRZZEIXLNBCKC-AREMUKBSSA-N |
| XLogP | 5.93 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|