C30H36N4S — CID 92501698
4-[(4S)-4-piperidin-1-yl-1-sulfanylidene-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-2-yl]benzonitrile (PubChem CID 92501698) has the molecular formula C30H36N4S and a molecular weight of 484.71 g/mol. Its IUPAC name is 4-[(4S)-4-piperidin-1-yl-1-sulfanylidene-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-2-yl]benzonitrile.
| Compound Name | 4-[(4S)-4-piperidin-1-yl-1-sulfanylidene-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 92501698 |
| Molecular Formula | C30H36N4S |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 4-[(4S)-4-piperidin-1-yl-1-sulfanylidene-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-2-yl]benzonitrile |
| SMILES | Cc1cc(C)c(/N=C2\[C@@H](N3CCCCC3)C3(CCCCC3)C(=S)N2c2ccc(C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C30H36N4S/c1-21-18-22(2)26(23(3)19-21)32-28-27(33-16-8-5-9-17-33)30(14-6-4-7-15-30)29(35)34(28)25-12-10-24(20-31)11-13-25/h10-13,18-19,27H,4-9,14-17H2,1-3H3/b32-28+/t27-/m1/s1 |
| InChIKey | GCGJBBPOAFDJBO-WABZQMDPSA-N |
| XLogP | 7.17 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|