About (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one
(5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one (PubChem CID 92503336) has the molecular formula C14H20BrN3O
and a molecular weight of 326.24 g/mol. Its IUPAC name is (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one.
Molecular Properties
| Compound Name | (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one |
| PubChem CID | 92503336 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one |
| SMILES | CCCCC[C@@]1(C)NC(=O)N(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C14H20BrN3O/c1-3-4-5-10-14(2)16-13(19)18(17-14)12-8-6-11(15)7-9-12/h6-9,17H,3-5,10H2,1-2H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | STQIGDOYYYBEPH-AWEZNQCLSA-N |
| XLogP | 3.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one?
The IUPAC name of (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one (CID 92503336) is (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one.
What is the SMILES notation for (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one?
The canonical SMILES for (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one is CCCCC[C@@]1(C)NC(=O)N(c2ccc(Br)cc2)N1.
What is the InChIKey of (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one?
The InChIKey is STQIGDOYYYBEPH-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H20BrN3O/c1-3-4-5-10-14(2)16-13(19)18(17-14)12-8-6-11(15)7-9-12/h6-9,17H,3-5,10H2,1-2H3,(H,16,19)/t14-/m0/s1.
What are the key properties of (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one?
(5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one has a molecular weight of 326.24 g/mol, XLogP of 3.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-(4-bromophenyl)-5-methyl-5-pentyl-1,2,4-triazolidin-3-one is sourced from PubChem (CID 92503336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).