C32H22FNO5 — CID 92507870
(1S,2R,3aS)-7-fluoro-2-(furan-2-yl)-1-(3-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 92507870) has the molecular formula C32H22FNO5 and a molecular weight of 519.53 g/mol. Its IUPAC name is (1S,2R,3aS)-7-fluoro-2-(furan-2-yl)-1-(3-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2R,3aS)-7-fluoro-2-(furan-2-yl)-1-(3-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 92507870 |
| Molecular Formula | C32H22FNO5 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (1S,2R,3aS)-7-fluoro-2-(furan-2-yl)-1-(3-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1cccc(C(=O)[C@@H]2[C@H](c3ccco3)C3(C(=O)c4ccccc4C3=O)[C@@H]3C=Cc4cc(F)ccc4N23)c1 |
| InChI | InChI=1S/C32H22FNO5/c1-38-21-7-4-6-19(17-21)29(35)28-27(25-10-5-15-39-25)32(30(36)22-8-2-3-9-23(22)31(32)37)26-14-11-18-16-20(33)12-13-24(18)34(26)28/h2-17,26-28H,1H3/t26-,27-,28-/m0/s1 |
| InChIKey | RZAKOMBVLCDMMK-KCHLEUMXSA-N |
| XLogP | 5.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|