C27H21N5O2 — CID 92508661
(2S,3R,10bR)-1,1-dicyano-2-(4-methoxyphenyl)-N-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-3-carboxamide (PubChem CID 92508661) has the molecular formula C27H21N5O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is (2S,3R,10bR)-1,1-dicyano-2-(4-methoxyphenyl)-N-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-3-carboxamide.
| Compound Name | (2S,3R,10bR)-1,1-dicyano-2-(4-methoxyphenyl)-N-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-3-carboxamide |
|---|---|
| PubChem CID | 92508661 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (2S,3R,10bR)-1,1-dicyano-2-(4-methoxyphenyl)-N-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-3-carboxamide |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)Nc3ccccc3)N3N=Cc4ccccc4[C@@H]3C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C27H21N5O2/c1-34-21-13-11-18(12-14-21)23-24(26(33)31-20-8-3-2-4-9-20)32-25(27(23,16-28)17-29)22-10-6-5-7-19(22)15-30-32/h2-15,23-25H,1H3,(H,31,33)/t23-,24-,25-/m1/s1 |
| InChIKey | LSGZBRFLYHCHTI-UBFVSLLYSA-N |
| XLogP | 4.22 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |