C22H24ClN3O5S — CID 92509453
1-(2-chloro-5-nitrophenyl)sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide (PubChem CID 92509453) has the molecular formula C22H24ClN3O5S and a molecular weight of 477.97 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-(2-chloro-5-nitrophenyl)sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92509453 |
| Molecular Formula | C22H24ClN3O5S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2ccccc21)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C22H24ClN3O5S/c23-19-9-8-17(26(28)29)14-21(19)32(30,31)25-12-10-16(11-13-25)22(27)24-20-7-3-5-15-4-1-2-6-18(15)20/h1-2,4,6,8-9,14,16,20H,3,5,7,10-13H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | LKWLCASWTCMQRD-HXUWFJFHSA-N |
| XLogP | 3.84 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|