C24H31N2O5+ — CID 9250960
methyl 2-[(1R)-2-[2-(2,4-dimethylanilino)-2-oxoethyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]acetate (PubChem CID 9250960) has the molecular formula C24H31N2O5+ and a molecular weight of 427.52 g/mol. Its IUPAC name is methyl 2-[(1R)-2-[2-(2,4-dimethylanilino)-2-oxoethyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]acetate.
| Compound Name | methyl 2-[(1R)-2-[2-(2,4-dimethylanilino)-2-oxoethyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]acetate |
|---|---|
| PubChem CID | 9250960 |
| Molecular Formula | C24H31N2O5+ |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | methyl 2-[(1R)-2-[2-(2,4-dimethylanilino)-2-oxoethyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]acetate |
| SMILES | COC(=O)C[C@@H]1c2cc(OC)c(OC)cc2CC[NH+]1CC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C24H30N2O5/c1-15-6-7-19(16(2)10-15)25-23(27)14-26-9-8-17-11-21(29-3)22(30-4)12-18(17)20(26)13-24(28)31-5/h6-7,10-12,20H,8-9,13-14H2,1-5H3,(H,25,27)/p+1/t20-/m1/s1 |
| InChIKey | NVMSKHVLQDKQPL-HXUWFJFHSA-O |
| XLogP | 2.00 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |