C15H24N2O5S — CID 92512484
2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-[(2R)-1-methoxypropan-2-yl]acetamide (PubChem CID 92512484) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-[(2R)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 92512484 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[(4-methoxy-3-methylphenyl)sulfonyl-methylamino]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@@H](C)NC(=O)CN(C)S(=O)(=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-11-8-13(6-7-14(11)22-5)23(19,20)17(3)9-15(18)16-12(2)10-21-4/h6-8,12H,9-10H2,1-5H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | ARTCYVKMQAUFFA-GFCCVEGCSA-N |
| XLogP | 0.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |