C16H18N2O4S — CID 92513136
(2R)-N-methyl-2-[4-(phenylsulfamoyl)phenoxy]propanamide (PubChem CID 92513136) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is (2R)-N-methyl-2-[4-(phenylsulfamoyl)phenoxy]propanamide.
| Compound Name | (2R)-N-methyl-2-[4-(phenylsulfamoyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 92513136 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2R)-N-methyl-2-[4-(phenylsulfamoyl)phenoxy]propanamide |
| SMILES | CNC(=O)[C@@H](C)Oc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-12(16(19)17-2)22-14-8-10-15(11-9-14)23(20,21)18-13-6-4-3-5-7-13/h3-12,18H,1-2H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | UPTQQCIVJPLIEZ-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |