C14H21NO3 — CID 925163
(2S)-N-tert-butyl-2-(4-methoxyphenoxy)propanamide (PubChem CID 925163) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-(4-methoxyphenoxy)propanamide.
| Compound Name | (2S)-N-tert-butyl-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 925163 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2S)-N-tert-butyl-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(O[C@@H](C)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21NO3/c1-10(13(16)15-14(2,3)4)18-12-8-6-11(17-5)7-9-12/h6-10H,1-5H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | QTRDITZTGRTFLY-JTQLQIEISA-N |
| XLogP | 2.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |