About (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 92518637) has the molecular formula C20H14N2O5
and a molecular weight of 362.34 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
| PubChem CID | 92518637 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2ccccc2n1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H14N2O5/c23-16-10-15(19(25)14-6-2-1-5-13(14)16)20(26)27-11-12-9-18(24)22-8-4-3-7-17(22)21-12/h1-10,23,25H,11H2 |
| InChIKey | SPYLANXJDDRCLZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate?
The IUPAC name of (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate (CID 92518637) is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate.
What is the SMILES notation for (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate?
The canonical SMILES for (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate is O=C(OCc1cc(=O)n2ccccc2n1)c1cc(O)c2ccccc2c1O.
What is the InChIKey of (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate?
The InChIKey is SPYLANXJDDRCLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O5/c23-16-10-15(19(25)14-6-2-1-5-13(14)16)20(26)27-11-12-9-18(24)22-8-4-3-7-17(22)21-12/h1-10,23,25H,11H2.
What are the key properties of (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate?
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate has a molecular weight of 362.34 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,4-dihydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 92518637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).