C13H7ClN6S — CID 9252063
4-[5-(3-chlorophenyl)tetrazol-2-yl]thieno[2,3-d]pyrimidine (PubChem CID 9252063) has the molecular formula C13H7ClN6S and a molecular weight of 314.76 g/mol. Its IUPAC name is 4-[5-(3-chlorophenyl)tetrazol-2-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[5-(3-chlorophenyl)tetrazol-2-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 9252063 |
| Molecular Formula | C13H7ClN6S |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-[5-(3-chlorophenyl)tetrazol-2-yl]thieno[2,3-d]pyrimidine |
| SMILES | Clc1cccc(-c2nnn(-c3ncnc4sccc34)n2)c1 |
| InChI | InChI=1S/C13H7ClN6S/c14-9-3-1-2-8(6-9)11-17-19-20(18-11)12-10-4-5-21-13(10)16-7-15-12/h1-7H |
| InChIKey | PTRDODJNROGLKG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |