C9H14O6 — CID 92523864
dimethyl (2R,6S)-4-hydroxyoxane-2,6-dicarboxylate (PubChem CID 92523864) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is dimethyl (2R,6S)-4-hydroxyoxane-2,6-dicarboxylate.
| Compound Name | dimethyl (2R,6S)-4-hydroxyoxane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 92523864 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | dimethyl (2R,6S)-4-hydroxyoxane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC(O)C[C@H](C(=O)OC)O1 |
| InChI | InChI=1S/C9H14O6/c1-13-8(11)6-3-5(10)4-7(15-6)9(12)14-2/h5-7,10H,3-4H2,1-2H3/t5?,6-,7+ |
| InChIKey | NJSLZZIIUSNWIW-DGUCWDHESA-N |
| XLogP | -0.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |