C10H10Br2N4O4 — CID 92524459
(2R,6S,7R)-2,6-dibromo-4,9,11-trimethyl-1,4,9,11-tetrazatricyclo[5.4.0.02,6]undecane-3,5,8,10-tetrone (PubChem CID 92524459) has the molecular formula C10H10Br2N4O4 and a molecular weight of 410.02 g/mol. Its IUPAC name is (2R,6S,7R)-2,6-dibromo-4,9,11-trimethyl-1,4,9,11-tetrazatricyclo[5.4.0.02,6]undecane-3,5,8,10-tetrone.
| Compound Name | (2R,6S,7R)-2,6-dibromo-4,9,11-trimethyl-1,4,9,11-tetrazatricyclo[5.4.0.02,6]undecane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 92524459 |
| Molecular Formula | C10H10Br2N4O4 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | (2R,6S,7R)-2,6-dibromo-4,9,11-trimethyl-1,4,9,11-tetrazatricyclo[5.4.0.02,6]undecane-3,5,8,10-tetrone |
| SMILES | CN1C(=O)[C@H]2N(N(C)C1=O)[C@@]1(Br)C(=O)N(C)C(=O)[C@@]21Br |
| InChI | InChI=1S/C10H10Br2N4O4/c1-13-5(17)4-9(11)6(18)14(2)7(19)10(9,12)16(4)15(3)8(13)20/h4H,1-3H3/t4-,9+,10+/m1/s1 |
| InChIKey | IKZDDRZLKYRSER-HMFASLLMSA-N |
| XLogP | -0.67 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|