C15H21N3O2 — CID 92524479
3-[(1S,2E)-2-hydroxyimino-1-phenylcyclohexyl]propanehydrazide (PubChem CID 92524479) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[(1S,2E)-2-hydroxyimino-1-phenylcyclohexyl]propanehydrazide.
| Compound Name | 3-[(1S,2E)-2-hydroxyimino-1-phenylcyclohexyl]propanehydrazide |
|---|---|
| PubChem CID | 92524479 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-[(1S,2E)-2-hydroxyimino-1-phenylcyclohexyl]propanehydrazide |
| SMILES | NNC(=O)CC[C@]1(c2ccccc2)CCCC/C1=N\O |
| InChI | InChI=1S/C15H21N3O2/c16-17-14(19)9-11-15(12-6-2-1-3-7-12)10-5-4-8-13(15)18-20/h1-3,6-7,20H,4-5,8-11,16H2,(H,17,19)/b18-13+/t15-/m0/s1 |
| InChIKey | XTPCRRRGXRLDAN-VUODPORTSA-N |
| XLogP | 2.10 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|