C30H29NO2 — CID 92524482
(2S)-2-[ethyl(2-hydroxyethyl)amino]-1,2-bis(4-phenylphenyl)ethanone (PubChem CID 92524482) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (2S)-2-[ethyl(2-hydroxyethyl)amino]-1,2-bis(4-phenylphenyl)ethanone.
| Compound Name | (2S)-2-[ethyl(2-hydroxyethyl)amino]-1,2-bis(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 92524482 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2S)-2-[ethyl(2-hydroxyethyl)amino]-1,2-bis(4-phenylphenyl)ethanone |
| SMILES | CCN(CCO)[C@H](C(=O)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NO2/c1-2-31(21-22-32)29(27-17-13-25(14-18-27)23-9-5-3-6-10-23)30(33)28-19-15-26(16-20-28)24-11-7-4-8-12-24/h3-20,29,32H,2,21-22H2,1H3/t29-/m0/s1 |
| InChIKey | OUUMPQIDYVRUGJ-LJAQVGFWSA-N |
| XLogP | 6.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |