C34H43NO — CID 92524788
N-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-phenylmethoxyphenyl)methanamine (PubChem CID 92524788) has the molecular formula C34H43NO and a molecular weight of 481.72 g/mol. Its IUPAC name is N-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-phenylmethoxyphenyl)methanamine.
| Compound Name | N-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-phenylmethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 92524788 |
| Molecular Formula | C34H43NO |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | N-[[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-(4-phenylmethoxyphenyl)methanamine |
| SMILES | CC(C)c1ccc2c(c1)CC[C@@H]1[C@](C)(CNCc3ccc(OCc4ccccc4)cc3)CCC[C@]21C |
| InChI | InChI=1S/C34H43NO/c1-25(2)28-13-17-31-29(21-28)14-18-32-33(3,19-8-20-34(31,32)4)24-35-22-26-11-15-30(16-12-26)36-23-27-9-6-5-7-10-27/h5-7,9-13,15-17,21,25,32,35H,8,14,18-20,22-24H2,1-4H3/t32-,33+,34-/m1/s1 |
| InChIKey | YOOHGKDQFVKYOV-OUYGKKDFSA-N |
| XLogP | 8.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |