C15H15ClN2O10S — CID 92525472
3-chloro-2-[[(3R,4E)-4-hydroxyimino-5-methoxy-3-methoxycarbonyl-2,5-dioxopentanoyl]amino]-5-methylbenzenesulfonic acid (PubChem CID 92525472) has the molecular formula C15H15ClN2O10S and a molecular weight of 450.81 g/mol. Its IUPAC name is 3-chloro-2-[[(3R,4E)-4-hydroxyimino-5-methoxy-3-methoxycarbonyl-2,5-dioxopentanoyl]amino]-5-methylbenzenesulfonic acid.
| Compound Name | 3-chloro-2-[[(3R,4E)-4-hydroxyimino-5-methoxy-3-methoxycarbonyl-2,5-dioxopentanoyl]amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 92525472 |
| Molecular Formula | C15H15ClN2O10S |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 3-chloro-2-[[(3R,4E)-4-hydroxyimino-5-methoxy-3-methoxycarbonyl-2,5-dioxopentanoyl]amino]-5-methylbenzenesulfonic acid |
| SMILES | COC(=O)/C(=N/O)[C@@H](C(=O)OC)C(=O)C(=O)Nc1c(Cl)cc(C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C15H15ClN2O10S/c1-6-4-7(16)10(8(5-6)29(24,25)26)17-13(20)12(19)9(14(21)27-2)11(18-23)15(22)28-3/h4-5,9,23H,1-3H3,(H,17,20)(H,24,25,26)/b18-11+/t9-/m1/s1 |
| InChIKey | KMFZEIBLKQAYCS-CLBHNAFJSA-N |
| XLogP | 0.20 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|