C19H18ClNO — CID 92525481
[(3aS,4S,9bS)-8-chloro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-phenylmethanone (PubChem CID 92525481) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is [(3aS,4S,9bS)-8-chloro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-phenylmethanone.
| Compound Name | [(3aS,4S,9bS)-8-chloro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92525481 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [(3aS,4S,9bS)-8-chloro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1Nc2ccc(Cl)cc2[C@H]2CCC[C@H]12 |
| InChI | InChI=1S/C19H18ClNO/c20-13-9-10-17-16(11-13)14-7-4-8-15(14)18(21-17)19(22)12-5-2-1-3-6-12/h1-3,5-6,9-11,14-15,18,21H,4,7-8H2/t14-,15-,18-/m0/s1 |
| InChIKey | POUGHTRFAOSGNI-MPGHIAIKSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |