C30H26N2 — CID 92525930
N-[(E)-[(4S,5S)-3,4,5-triphenylcyclohex-2-en-1-ylidene]amino]aniline (PubChem CID 92525930) has the molecular formula C30H26N2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[(E)-[(4S,5S)-3,4,5-triphenylcyclohex-2-en-1-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(4S,5S)-3,4,5-triphenylcyclohex-2-en-1-ylidene]amino]aniline |
|---|---|
| PubChem CID | 92525930 |
| Molecular Formula | C30H26N2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(E)-[(4S,5S)-3,4,5-triphenylcyclohex-2-en-1-ylidene]amino]aniline |
| SMILES | C1=C(c2ccccc2)[C@H](c2ccccc2)[C@@H](c2ccccc2)C/C1=N\Nc1ccccc1 |
| InChI | InChI=1S/C30H26N2/c1-5-13-23(14-6-1)28-21-27(32-31-26-19-11-4-12-20-26)22-29(24-15-7-2-8-16-24)30(28)25-17-9-3-10-18-25/h1-21,29-31H,22H2/b32-27-/t29-,30+/m1/s1 |
| InChIKey | ZXQLPFHZTSVVFY-UIXFFJCMSA-N |
| XLogP | 7.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|