C13H17BrN3O4+ — CID 9252609
[2-(2-bromoanilino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium (PubChem CID 9252609) has the molecular formula C13H17BrN3O4+ and a molecular weight of 359.20 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9252609 |
| Molecular Formula | C13H17BrN3O4+ |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium |
| SMILES | COC(=O)NC(=O)C[NH+](C)CC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C13H16BrN3O4/c1-17(8-12(19)16-13(20)21-2)7-11(18)15-10-6-4-3-5-9(10)14/h3-6H,7-8H2,1-2H3,(H,15,18)(H,16,19,20)/p+1 |
| InChIKey | IUKQOHKDVAQCIW-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |