C14H14N2O4 — CID 92526608
dimethyl (1S,2R,3S,4R,7R,8S)-7,8-dicyanobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 92526608) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4R,7R,8S)-7,8-dicyanobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4R,7R,8S)-7,8-dicyanobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 92526608 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | dimethyl (1S,2R,3S,4R,7R,8S)-7,8-dicyanobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@H]([C@H](C#N)[C@@H]2C#N)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H14N2O4/c1-19-13(17)11-7-3-4-8(12(11)14(18)20-2)10(6-16)9(7)5-15/h3-4,7-12H,1-2H3/t7-,8+,9+,10-,11+,12- |
| InChIKey | RGRFZPGPQZACRF-WAODVVSYSA-N |
| XLogP | 0.66 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|