C18H18N2O2 — CID 92528251
(3R)-3-(4-methylanilino)-1-(3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 92528251) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3R)-3-(4-methylanilino)-1-(3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-methylanilino)-1-(3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92528251 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3R)-3-(4-methylanilino)-1-(3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N[C@@H]2CC(=O)N(c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-12-6-8-14(9-7-12)19-16-11-17(21)20(18(16)22)15-5-3-4-13(2)10-15/h3-10,16,19H,11H2,1-2H3/t16-/m1/s1 |
| InChIKey | GSVCRJZMNLMDJB-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|