About (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one
(2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one (PubChem CID 92528936) has the molecular formula C22H30O4
and a molecular weight of 358.48 g/mol. Its IUPAC name is (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one |
| PubChem CID | 92528936 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one |
| SMILES | O=C1CCCCC[C@@H]1Cc1cc(O)c(C[C@@H]2CCCCCC2=O)cc1O |
| InChI | InChI=1S/C22H30O4/c23-19-9-5-1-3-7-15(19)11-17-13-22(26)18(14-21(17)25)12-16-8-4-2-6-10-20(16)24/h13-16,25-26H,1-12H2/t15-,16+ |
| InChIKey | SAIVAXSJCXPLEJ-IYBDPMFKSA-N |
| XLogP | 4.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one?
The IUPAC name of (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one (CID 92528936) is (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one.
What is the SMILES notation for (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one?
The canonical SMILES for (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one is O=C1CCCCC[C@@H]1Cc1cc(O)c(C[C@@H]2CCCCCC2=O)cc1O.
What is the InChIKey of (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one?
The InChIKey is SAIVAXSJCXPLEJ-IYBDPMFKSA-N. The full InChI is InChI=1S/C22H30O4/c23-19-9-5-1-3-7-15(19)11-17-13-22(26)18(14-21(17)25)12-16-8-4-2-6-10-20(16)24/h13-16,25-26H,1-12H2/t15-,16+.
What are the key properties of (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one?
(2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one has a molecular weight of 358.48 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[2,5-dihydroxy-4-[[(1S)-2-oxocycloheptyl]methyl]phenyl]methyl]cycloheptan-1-one is sourced from PubChem (CID 92528936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).