C18H12Cl2N2OS — CID 92529222
(2S,3R,5R,6R)-2,6-bis(4-chlorophenyl)-1,4-oxathiane-3,5-dicarbonitrile (PubChem CID 92529222) has the molecular formula C18H12Cl2N2OS and a molecular weight of 375.28 g/mol. Its IUPAC name is (2S,3R,5R,6R)-2,6-bis(4-chlorophenyl)-1,4-oxathiane-3,5-dicarbonitrile.
| Compound Name | (2S,3R,5R,6R)-2,6-bis(4-chlorophenyl)-1,4-oxathiane-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 92529222 |
| Molecular Formula | C18H12Cl2N2OS |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | (2S,3R,5R,6R)-2,6-bis(4-chlorophenyl)-1,4-oxathiane-3,5-dicarbonitrile |
| SMILES | N#C[C@H]1S[C@H](C#N)[C@H](c2ccc(Cl)cc2)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2N2OS/c19-13-5-1-11(2-6-13)17-15(9-21)24-16(10-22)18(23-17)12-3-7-14(20)8-4-12/h1-8,15-18H/t15-,16-,17-,18+/m1/s1 |
| InChIKey | IHIYKSDCXKJPOG-TVFCKZIOSA-N |
| XLogP | 5.32 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |