C28H46N2O — CID 92529681
(2R)-N-methyl-N-[[4-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine (PubChem CID 92529681) has the molecular formula C28H46N2O and a molecular weight of 426.69 g/mol. Its IUPAC name is (2R)-N-methyl-N-[[4-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine.
| Compound Name | (2R)-N-methyl-N-[[4-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 92529681 |
| Molecular Formula | C28H46N2O |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.36 |
| IUPAC Name | (2R)-N-methyl-N-[[4-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine |
| SMILES | CC1=C(CC[C@@H](C)N(C)Cc2ccc(OCCCN3CCCC3)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H46N2O/c1-23-10-8-17-28(3,4)27(23)16-11-24(2)29(5)22-25-12-14-26(15-13-25)31-21-9-20-30-18-6-7-19-30/h12-15,24H,6-11,16-22H2,1-5H3/t24-/m1/s1 |
| InChIKey | RBXOPQWTFVHNTK-XMMPIXPASA-N |
| XLogP | 6.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|