C17H12Cl2N4O4 — CID 92530343
2-cyano-N-[(Z)-[2-[(3R)-4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl]-1-(furan-2-yl)ethylidene]amino]acetamide (PubChem CID 92530343) has the molecular formula C17H12Cl2N4O4 and a molecular weight of 407.21 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-[2-[(3R)-4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl]-1-(furan-2-yl)ethylidene]amino]acetamide.
| Compound Name | 2-cyano-N-[(Z)-[2-[(3R)-4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl]-1-(furan-2-yl)ethylidene]amino]acetamide |
|---|---|
| PubChem CID | 92530343 |
| Molecular Formula | C17H12Cl2N4O4 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-cyano-N-[(Z)-[2-[(3R)-4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl]-1-(furan-2-yl)ethylidene]amino]acetamide |
| SMILES | N#CCC(=O)N/N=C(/C[C@]1(O)C(=O)Nc2c(Cl)ccc(Cl)c21)c1ccco1 |
| InChI | InChI=1S/C17H12Cl2N4O4/c18-9-3-4-10(19)15-14(9)17(26,16(25)21-15)8-11(12-2-1-7-27-12)22-23-13(24)5-6-20/h1-4,7,26H,5,8H2,(H,21,25)(H,23,24)/b22-11-/t17-/m1/s1 |
| InChIKey | MNZABRQENXPLLL-FIJRTHIRSA-N |
| XLogP | 2.55 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|