C10H14N2O2S — CID 92530739
ethyl (5R)-4-methyl-2-prop-2-enylimino-5H-1,3-thiazole-5-carboxylate (PubChem CID 92530739) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is ethyl (5R)-4-methyl-2-prop-2-enylimino-5H-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl (5R)-4-methyl-2-prop-2-enylimino-5H-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 92530739 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl (5R)-4-methyl-2-prop-2-enylimino-5H-1,3-thiazole-5-carboxylate |
| SMILES | C=CC/N=C1\N=C(C)[C@H](C(=O)OCC)S1 |
| InChI | InChI=1S/C10H14N2O2S/c1-4-6-11-10-12-7(3)8(15-10)9(13)14-5-2/h4,8H,1,5-6H2,2-3H3/b11-10+/t8-/m1/s1 |
| InChIKey | TZBXXJJVVBZVHF-IRXCETGXSA-N |
| XLogP | 1.67 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|