C11H7Cl3N2 — CID 92532642
2-[(Z)-3,3,3-trichloroprop-1-enyl]quinoxaline (PubChem CID 92532642) has the molecular formula C11H7Cl3N2 and a molecular weight of 273.55 g/mol. Its IUPAC name is 2-[(Z)-3,3,3-trichloroprop-1-enyl]quinoxaline.
| Compound Name | 2-[(Z)-3,3,3-trichloroprop-1-enyl]quinoxaline |
|---|---|
| PubChem CID | 92532642 |
| Molecular Formula | C11H7Cl3N2 |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2-[(Z)-3,3,3-trichloroprop-1-enyl]quinoxaline |
| SMILES | ClC(Cl)(Cl)/C=C\c1cnc2ccccc2n1 |
| InChI | InChI=1S/C11H7Cl3N2/c12-11(13,14)6-5-8-7-15-9-3-1-2-4-10(9)16-8/h1-7H/b6-5- |
| InChIKey | UPAOWTAFCNXMEO-WAYWQWQTSA-N |
| XLogP | 4.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|