About (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one
(4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one (PubChem CID 92532667) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one |
| PubChem CID | 92532667 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one |
| SMILES | C[C@H]1CC(=O)NC(N)=N1 |
| InChI | InChI=1S/C5H9N3O/c1-3-2-4(9)8-5(6)7-3/h3H,2H2,1H3,(H3,6,7,8,9)/t3-/m0/s1 |
| InChIKey | CYYAGBJALIGBOD-VKHMYHEASA-N |
| XLogP | -0.79 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one?
The IUPAC name of (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one (CID 92532667) is (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one.
What is the SMILES notation for (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one?
The canonical SMILES for (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one is C[C@H]1CC(=O)NC(N)=N1.
What is the InChIKey of (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one?
The InChIKey is CYYAGBJALIGBOD-VKHMYHEASA-N. The full InChI is InChI=1S/C5H9N3O/c1-3-2-4(9)8-5(6)7-3/h3H,2H2,1H3,(H3,6,7,8,9)/t3-/m0/s1.
What are the key properties of (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one?
(4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one has a molecular weight of 127.15 g/mol, XLogP of -0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-amino-4-methyl-4,5-dihydro-1H-pyrimidin-6-one is sourced from PubChem (CID 92532667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).