C11H21N3O2 — CID 92533024
1-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3-prop-2-enylurea (PubChem CID 92533024) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3-prop-2-enylurea.
| Compound Name | 1-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 92533024 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C11H21N3O2/c1-4-5-12-11(15)13-8-14-6-9(2)16-10(3)7-14/h4,9-10H,1,5-8H2,2-3H3,(H2,12,13,15)/t9-,10+ |
| InChIKey | CSFKOOASRXLKDY-AOOOYVTPSA-N |
| XLogP | 0.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|