C12H22O2 — CID 92533073
(4R,7S)-4,7-dimethyldeca-1,9-diene-4,7-diol (PubChem CID 92533073) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (4R,7S)-4,7-dimethyldeca-1,9-diene-4,7-diol.
| Compound Name | (4R,7S)-4,7-dimethyldeca-1,9-diene-4,7-diol |
|---|---|
| PubChem CID | 92533073 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4R,7S)-4,7-dimethyldeca-1,9-diene-4,7-diol |
| SMILES | C=CC[C@](C)(O)CC[C@](C)(O)CC=C |
| InChI | InChI=1S/C12H22O2/c1-5-7-11(3,13)9-10-12(4,14)8-6-2/h5-6,13-14H,1-2,7-10H2,3-4H3/t11-,12+ |
| InChIKey | SUGURHSYSLGELB-TXEJJXNPSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|