C24H21N3O3 — CID 9253400
N-benzyl-3-[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]oxybenzamide (PubChem CID 9253400) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-benzyl-3-[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]oxybenzamide.
| Compound Name | N-benzyl-3-[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 9253400 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-benzyl-3-[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]oxybenzamide |
| SMILES | C[C@@H](Oc1cccc(C(=O)NCc2ccccc2)c1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C24H21N3O3/c1-17(23(28)27-22-13-6-5-10-20(22)15-25)30-21-12-7-11-19(14-21)24(29)26-16-18-8-3-2-4-9-18/h2-14,17H,16H2,1H3,(H,26,29)(H,27,28)/t17-/m1/s1 |
| InChIKey | WMQGSXGDGCVTIO-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |