C20H22N6O2 — CID 92534216
1-N,4-N-bis[(Z)-[(2S)-3,4-dihydro-2H-pyran-2-yl]methylideneamino]phthalazine-1,4-diamine (PubChem CID 92534216) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-N,4-N-bis[(Z)-[(2S)-3,4-dihydro-2H-pyran-2-yl]methylideneamino]phthalazine-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(Z)-[(2S)-3,4-dihydro-2H-pyran-2-yl]methylideneamino]phthalazine-1,4-diamine |
|---|---|
| PubChem CID | 92534216 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-N,4-N-bis[(Z)-[(2S)-3,4-dihydro-2H-pyran-2-yl]methylideneamino]phthalazine-1,4-diamine |
| SMILES | C1=CO[C@H](/C=N\Nc2nnc(N/N=C\[C@@H]3CCC=CO3)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H22N6O2/c1-2-10-18-17(9-1)19(23-21-13-15-7-3-5-11-27-15)25-26-20(18)24-22-14-16-8-4-6-12-28-16/h1-2,5-6,9-16H,3-4,7-8H2,(H,23,25)(H,24,26)/b21-13-,22-14-/t15-,16-/m0/s1 |
| InChIKey | NVQOTXWCYFQIKD-ROXWWLGHSA-N |
| XLogP | 3.81 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|