C21H19ClN2O2 — CID 92534595
(2S)-2-(4-chlorophenoxy)-N-[4-(pyridin-4-ylmethyl)phenyl]propanamide (PubChem CID 92534595) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[4-(pyridin-4-ylmethyl)phenyl]propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[4-(pyridin-4-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 92534595 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[4-(pyridin-4-ylmethyl)phenyl]propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C21H19ClN2O2/c1-15(26-20-8-4-18(22)5-9-20)21(25)24-19-6-2-16(3-7-19)14-17-10-12-23-13-11-17/h2-13,15H,14H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | TYOWKMWZPLPVSF-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |