C26H23N5O — CID 92535647
N-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-phenylquinazolin-4-amine (PubChem CID 92535647) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-phenylquinazolin-4-amine.
| Compound Name | N-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 92535647 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-2-phenylquinazolin-4-amine |
| SMILES | COc1cccc([C@@H](Nc2nc(-c3ccccc3)nc3ccccc23)c2nccn2C)c1 |
| InChI | InChI=1S/C26H23N5O/c1-31-16-15-27-26(31)23(19-11-8-12-20(17-19)32-2)29-25-21-13-6-7-14-22(21)28-24(30-25)18-9-4-3-5-10-18/h3-17,23H,1-2H3,(H,28,29,30)/t23-/m1/s1 |
| InChIKey | VEJHQXKFWDIMLH-HSZRJFAPSA-N |
| XLogP | 5.24 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |