C15H24N3O3+ — CID 9253639
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methyl-2-piperidin-1-ium-1-ylacetamide (PubChem CID 9253639) has the molecular formula C15H24N3O3+ and a molecular weight of 294.37 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methyl-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methyl-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 9253639 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methyl-2-piperidin-1-ium-1-ylacetamide |
| SMILES | CN(CC(=O)NCc1ccco1)C(=O)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C15H23N3O3/c1-17(15(20)12-18-7-3-2-4-8-18)11-14(19)16-10-13-6-5-9-21-13/h5-6,9H,2-4,7-8,10-12H2,1H3,(H,16,19)/p+1 |
| InChIKey | OQYGMIITYBCCHQ-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |