C23H20N2O2 — CID 92536781
[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl] 4-phenyldiazenylbenzoate (PubChem CID 92536781) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is [(2R)-1,2,3,4-tetrahydronaphthalen-2-yl] 4-phenyldiazenylbenzoate.
| Compound Name | [(2R)-1,2,3,4-tetrahydronaphthalen-2-yl] 4-phenyldiazenylbenzoate |
|---|---|
| PubChem CID | 92536781 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(2R)-1,2,3,4-tetrahydronaphthalen-2-yl] 4-phenyldiazenylbenzoate |
| SMILES | O=C(O[C@@H]1CCc2ccccc2C1)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2/c26-23(27-22-15-12-17-6-4-5-7-19(17)16-22)18-10-13-21(14-11-18)25-24-20-8-2-1-3-9-20/h1-11,13-14,22H,12,15-16H2/b25-24+/t22-/m1/s1 |
| InChIKey | CXLUPFYKXALWMT-GJQPQMNHSA-N |
| XLogP | 5.82 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|