About 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one
2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 9253765) has the molecular formula C21H26N4O+2
and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 9253765 |
| Molecular Formula | C21H26N4O+2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccc2nc(C[NH+]3CC[NH+](Cc4ccccc4)CC3)cc(=O)n12 |
| InChI | InChI=1S/C21H24N4O/c1-17-6-5-9-20-22-19(14-21(26)25(17)20)16-24-12-10-23(11-13-24)15-18-7-3-2-4-8-18/h2-9,14H,10-13,15-16H2,1H3/p+2 |
| InChIKey | AFLVLZYRODOOGU-UHFFFAOYSA-P |
| XLogP | -0.51 |
| TPSA | 43.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one (CID 9253765) is 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one is Cc1cccc2nc(C[NH+]3CC[NH+](Cc4ccccc4)CC3)cc(=O)n12.
What is the InChIKey of 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is AFLVLZYRODOOGU-UHFFFAOYSA-P. The full InChI is InChI=1S/C21H24N4O/c1-17-6-5-9-20-22-19(14-21(26)25(17)20)16-24-12-10-23(11-13-24)15-18-7-3-2-4-8-18/h2-9,14H,10-13,15-16H2,1H3/p+2.
What are the key properties of 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one?
2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 350.47 g/mol, XLogP of -0.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-6-methylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 9253765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).