C13H23N2O2+ — CID 92541593
2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl-trimethylazanium (PubChem CID 92541593) has the molecular formula C13H23N2O2+ and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl-trimethylazanium.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 92541593 |
| Molecular Formula | C13H23N2O2+ |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C13H23N2O2/c1-15(2,3)9-8-14-12(16)10-6-4-5-7-11(10)13(14)17/h10-11H,4-9H2,1-3H3/q+1/t10-,11-/m0/s1 |
| InChIKey | ASNGCLKEZFFCDA-QWRGUYRKSA-N |
| XLogP | 0.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|