C18H13BrClN5O3 — CID 92541715
2-[(3aR,6aS)-5-(3-bromophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 92541715) has the molecular formula C18H13BrClN5O3 and a molecular weight of 462.69 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-(3-bromophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(3aR,6aS)-5-(3-bromophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 92541715 |
| Molecular Formula | C18H13BrClN5O3 |
| Molecular Weight | 462.69 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 2-[(3aR,6aS)-5-(3-bromophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(CN1N=N[C@@H]2C(=O)N(c3cccc(Br)c3)C(=O)[C@@H]21)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13BrClN5O3/c19-10-2-1-3-13(8-10)25-17(27)15-16(18(25)28)24(23-22-15)9-14(26)21-12-6-4-11(20)5-7-12/h1-8,15-16H,9H2,(H,21,26)/t15-,16+/m0/s1 |
| InChIKey | FTNVGMBCGGIQIS-JKSUJKDBSA-N |
| XLogP | 3.03 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|